C21H20N6O — CID 174783039
2,4-diphenyl-1,5-bis(1,2,4-triazol-1-yl)pentan-3-one (PubChem CID 174783039) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 2,4-diphenyl-1,5-bis(1,2,4-triazol-1-yl)pentan-3-one.
| Compound Name | 2,4-diphenyl-1,5-bis(1,2,4-triazol-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 174783039 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2,4-diphenyl-1,5-bis(1,2,4-triazol-1-yl)pentan-3-one |
| SMILES | O=C(C(Cn1cncn1)c1ccccc1)C(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C21H20N6O/c28-21(19(11-26-15-22-13-24-26)17-7-3-1-4-8-17)20(12-27-16-23-14-25-27)18-9-5-2-6-10-18/h1-10,13-16,19-20H,11-12H2 |
| InChIKey | LKZFLRPHBFESSG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |