About [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride
[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride (PubChem CID 134693458) has the molecular formula C18H18ClN3O2
and a molecular weight of 343.81 g/mol. Its IUPAC name is [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride.
Molecular Properties
| Compound Name | [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride |
| PubChem CID | 134693458 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccc1)OC(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2.ClH/c22-18(11-15-7-3-1-4-8-15)23-17(12-21-14-19-13-20-21)16-9-5-2-6-10-16;/h1-10,13-14,17H,11-12H2;1H |
| InChIKey | KDCJNESAAPAQJL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride?
The IUPAC name of [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride (CID 134693458) is [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride.
What is the SMILES notation for [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride?
The canonical SMILES for [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride is Cl.O=C(Cc1ccccc1)OC(Cn1cncn1)c1ccccc1.
What is the InChIKey of [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride?
The InChIKey is KDCJNESAAPAQJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2.ClH/c22-18(11-15-7-3-1-4-8-15)23-17(12-21-14-19-13-20-21)16-9-5-2-6-10-16;/h1-10,13-14,17H,11-12H2;1H.
What are the key properties of [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride?
[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride has a molecular weight of 343.81 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride is sourced from PubChem (CID 134693458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).