C18H18ClN3O2 — CID 134693458
[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride (PubChem CID 134693458) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride.
| Compound Name | [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 134693458 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] 2-phenylacetate;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccc1)OC(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2.ClH/c22-18(11-15-7-3-1-4-8-15)23-17(12-21-14-19-13-20-21)16-9-5-2-6-10-16;/h1-10,13-14,17H,11-12H2;1H |
| InChIKey | KDCJNESAAPAQJL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |