About 1-phenylpropyl 2-pyridin-4-ylacetate
1-phenylpropyl 2-pyridin-4-ylacetate (PubChem CID 11780100) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-phenylpropyl 2-pyridin-4-ylacetate.
Molecular Properties
| Compound Name | 1-phenylpropyl 2-pyridin-4-ylacetate |
| PubChem CID | 11780100 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-phenylpropyl 2-pyridin-4-ylacetate |
| SMILES | CCC(OC(=O)Cc1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-2-15(14-6-4-3-5-7-14)19-16(18)12-13-8-10-17-11-9-13/h3-11,15H,2,12H2,1H3 |
| InChIKey | ULVGJJYLCYOFCL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylpropyl 2-pyridin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropyl 2-pyridin-4-ylacetate?
The IUPAC name of 1-phenylpropyl 2-pyridin-4-ylacetate (CID 11780100) is 1-phenylpropyl 2-pyridin-4-ylacetate.
What is the SMILES notation for 1-phenylpropyl 2-pyridin-4-ylacetate?
The canonical SMILES for 1-phenylpropyl 2-pyridin-4-ylacetate is CCC(OC(=O)Cc1ccncc1)c1ccccc1.
What is the InChIKey of 1-phenylpropyl 2-pyridin-4-ylacetate?
The InChIKey is ULVGJJYLCYOFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-2-15(14-6-4-3-5-7-14)19-16(18)12-13-8-10-17-11-9-13/h3-11,15H,2,12H2,1H3.
What are the key properties of 1-phenylpropyl 2-pyridin-4-ylacetate?
1-phenylpropyl 2-pyridin-4-ylacetate has a molecular weight of 255.32 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropyl 2-pyridin-4-ylacetate is sourced from PubChem (CID 11780100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).