C18H19N5O2 — CID 97318897
[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] (6R)-4,5,6,7-tetrahydro-1H-indazole-6-carboxylate (PubChem CID 97318897) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is [(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] (6R)-4,5,6,7-tetrahydro-1H-indazole-6-carboxylate.
| Compound Name | [(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] (6R)-4,5,6,7-tetrahydro-1H-indazole-6-carboxylate |
|---|---|
| PubChem CID | 97318897 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl] (6R)-4,5,6,7-tetrahydro-1H-indazole-6-carboxylate |
| SMILES | O=C(O[C@H](Cn1cncn1)c1ccccc1)[C@@H]1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C18H19N5O2/c24-18(14-6-7-15-9-20-22-16(15)8-14)25-17(10-23-12-19-11-21-23)13-4-2-1-3-5-13/h1-5,9,11-12,14,17H,6-8,10H2,(H,20,22)/t14-,17-/m1/s1 |
| InChIKey | ZACGBJZJZQMOSR-RHSMWYFYSA-N |
| XLogP | 2.09 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |