C8H11N3O — CID 129322075
(6S)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide (PubChem CID 129322075) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is (6S)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide.
| Compound Name | (6S)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 129322075 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (6S)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide |
| SMILES | NC(=O)[C@H]1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C8H11N3O/c9-8(12)5-1-2-6-4-10-11-7(6)3-5/h4-5H,1-3H2,(H2,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | SYTDAZYDLGJXID-YFKPBYRVSA-N |
| XLogP | -0.00 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |