C14H14ClN3O2 — CID 86785947
N-(3-chloro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide (PubChem CID 86785947) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 86785947 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)C1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C14H14ClN3O2/c15-11-6-10(3-4-13(11)19)17-14(20)8-1-2-9-7-16-18-12(9)5-8/h3-4,6-8,19H,1-2,5H2,(H,16,18)(H,17,20) |
| InChIKey | CETCGUZOMSEPGL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|