methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate

C8H10N2O2 — CID 99996671

IUPACmethyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate
SMILESCOC(=O)[C@@H]1Cc2cn[nH]c2C1
InChIInChI=1S/C8H10N2O2/c1-12-8(11)5-2-6-4-9-10-7(6)3-5/h4-5H,2-3H2,1H3,(H,9,10)/t5-/m1/s1
InChIKeyHNHHQCSMWFPQSN-RXMQYKEDSA-N
MW166.18 g/mol
LogP0.30
Rot. Bonds1

About methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate

methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate (PubChem CID 99996671) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate.

Molecular Properties

Compound Namemethyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate
PubChem CID99996671
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Namemethyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate
SMILESCOC(=O)[C@@H]1Cc2cn[nH]c2C1
InChIInChI=1S/C8H10N2O2/c1-12-8(11)5-2-6-4-9-10-7(6)3-5/h4-5H,2-3H2,1H3,(H,9,10)/t5-/m1/s1
InChIKeyHNHHQCSMWFPQSN-RXMQYKEDSA-N
XLogP0.30
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate?
The IUPAC name of methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate (CID 99996671) is methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate.
What is the SMILES notation for methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate?
The canonical SMILES for methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate is COC(=O)[C@@H]1Cc2cn[nH]c2C1.
What is the InChIKey of methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate?
The InChIKey is HNHHQCSMWFPQSN-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-12-8(11)5-2-6-4-9-10-7(6)3-5/h4-5H,2-3H2,1H3,(H,9,10)/t5-/m1/s1.
What are the key properties of methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate?
methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate has a molecular weight of 166.18 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5R)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-5-carboxylate is sourced from PubChem (CID 99996671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).