C11H11N3O2 — CID 63073894
2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid (PubChem CID 63073894) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid.
| Compound Name | 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 63073894 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid |
| SMILES | O=C(O)C(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O2/c15-11(16)10(6-14-8-12-7-13-14)9-4-2-1-3-5-9/h1-5,7-8,10H,6H2,(H,15,16) |
| InChIKey | CXKSYKASVRCATD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |