2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid

C11H11N3O2 — CID 63073894

IUPAC2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESO=C(O)C(Cn1cncn1)c1ccccc1
InChIInChI=1S/C11H11N3O2/c15-11(16)10(6-14-8-12-7-13-14)9-4-2-1-3-5-9/h1-5,7-8,10H,6H2,(H,15,16)
InChIKeyCXKSYKASVRCATD-UHFFFAOYSA-N
MW217.23 g/mol
LogP1.15
Rot. Bonds4

About 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid

2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid (PubChem CID 63073894) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid.

Molecular Properties

Compound Name2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid
PubChem CID63073894
Molecular FormulaC11H11N3O2
Molecular Weight217.23 g/mol
Exact Mass217.09
IUPAC Name2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESO=C(O)C(Cn1cncn1)c1ccccc1
InChIInChI=1S/C11H11N3O2/c15-11(16)10(6-14-8-12-7-13-14)9-4-2-1-3-5-9/h1-5,7-8,10H,6H2,(H,15,16)
InChIKeyCXKSYKASVRCATD-UHFFFAOYSA-N
XLogP1.15
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.23
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid (CID 63073894) is 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid is O=C(O)C(Cn1cncn1)c1ccccc1.
What is the InChIKey of 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is CXKSYKASVRCATD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c15-11(16)10(6-14-8-12-7-13-14)9-4-2-1-3-5-9/h1-5,7-8,10H,6H2,(H,15,16).
What are the key properties of 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid?
2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 217.23 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-(1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 63073894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).