C12H13N3O2 — CID 10977307
4-hydroxy-3-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one (PubChem CID 10977307) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 4-hydroxy-3-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one.
| Compound Name | 4-hydroxy-3-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 10977307 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-hydroxy-3-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one |
| SMILES | O=C(Cn1cncn1)C(CO)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2/c16-7-11(10-4-2-1-3-5-10)12(17)6-15-9-13-8-14-15/h1-5,8-9,11,16H,6-7H2 |
| InChIKey | SLAOEFVVCVVUBP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |