C12H12N3O2- — CID 19095984
2-phenyl-4-(1,2,4-triazol-1-yl)butanoate (PubChem CID 19095984) has the molecular formula C12H12N3O2- and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-phenyl-4-(1,2,4-triazol-1-yl)butanoate.
| Compound Name | 2-phenyl-4-(1,2,4-triazol-1-yl)butanoate |
|---|---|
| PubChem CID | 19095984 |
| Molecular Formula | C12H12N3O2- |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-phenyl-4-(1,2,4-triazol-1-yl)butanoate |
| SMILES | O=C([O-])C(CCn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2/c16-12(17)11(10-4-2-1-3-5-10)6-7-15-9-13-8-14-15/h1-5,8-9,11H,6-7H2,(H,16,17)/p-1 |
| InChIKey | DUCPDYBMWKBEDX-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |