C14H16N4O3 — CID 43211205
3-phenyl-3-[3-(1,2,4-triazol-1-yl)propanoylamino]propanoic acid (PubChem CID 43211205) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-phenyl-3-[3-(1,2,4-triazol-1-yl)propanoylamino]propanoic acid.
| Compound Name | 3-phenyl-3-[3-(1,2,4-triazol-1-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 43211205 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-phenyl-3-[3-(1,2,4-triazol-1-yl)propanoylamino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CCn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C14H16N4O3/c19-13(6-7-18-10-15-9-16-18)17-12(8-14(20)21)11-4-2-1-3-5-11/h1-5,9-10,12H,6-8H2,(H,17,19)(H,20,21) |
| InChIKey | PGIJUUAHIFBYFK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |