C16H18N4O — CID 97057406
N-[(1R)-1-phenylbut-3-ynyl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 97057406) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(1R)-1-phenylbut-3-ynyl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[(1R)-1-phenylbut-3-ynyl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 97057406 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[(1R)-1-phenylbut-3-ynyl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | C#CC[C@@H](NC(=O)CCCn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O/c1-2-7-15(14-8-4-3-5-9-14)19-16(21)10-6-11-20-13-17-12-18-20/h1,3-5,8-9,12-13,15H,6-7,10-11H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | ZTNWXEROUUTPEP-OAHLLOKOSA-N |
| XLogP | 1.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|