C17H16FN3O — CID 150440123
1-fluoro-1,2-diphenyl-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 150440123) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-fluoro-1,2-diphenyl-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-fluoro-1,2-diphenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 150440123 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-fluoro-1,2-diphenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(Cn1cncn1)(c1ccccc1)C(F)c1ccccc1 |
| InChI | InChI=1S/C17H16FN3O/c18-16(14-7-3-1-4-8-14)17(22,11-21-13-19-12-20-21)15-9-5-2-6-10-15/h1-10,12-13,16,22H,11H2 |
| InChIKey | HLPDEGMAKXQMQN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |