C13H17N3O3 — CID 13491628
1,1-dimethoxy-2-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 13491628) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1,1-dimethoxy-2-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1,1-dimethoxy-2-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 13491628 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1,1-dimethoxy-2-phenyl-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | COC(OC)C(O)(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O3/c1-18-12(19-2)13(17,8-16-10-14-9-15-16)11-6-4-3-5-7-11/h3-7,9-10,12,17H,8H2,1-2H3 |
| InChIKey | RRXUVRJDEAZYIG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|