C16H24ClN3OSi — CID 139941557
2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpentan-2-ol (PubChem CID 139941557) has the molecular formula C16H24ClN3OSi and a molecular weight of 337.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpentan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpentan-2-ol |
|---|---|
| PubChem CID | 139941557 |
| Molecular Formula | C16H24ClN3OSi |
| Molecular Weight | 337.93 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpentan-2-ol |
| SMILES | CCC(C(O)(Cn1cncn1)c1ccc(Cl)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H24ClN3OSi/c1-5-15(22(2,3)4)16(21,10-20-12-18-11-19-20)13-6-8-14(17)9-7-13/h6-9,11-12,15,21H,5,10H2,1-4H3 |
| InChIKey | XITFDBXATBYQTE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|