C16H14Cl3N3O — CID 12782945
1,1-bis(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanol;hydrochloride (PubChem CID 12782945) has the molecular formula C16H14Cl3N3O and a molecular weight of 370.67 g/mol. Its IUPAC name is 1,1-bis(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanol;hydrochloride.
| Compound Name | 1,1-bis(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 12782945 |
| Molecular Formula | C16H14Cl3N3O |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 1,1-bis(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanol;hydrochloride |
| SMILES | Cl.OC(Cn1cncn1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2N3O.ClH/c17-14-5-1-12(2-6-14)16(22,9-21-11-19-10-20-21)13-3-7-15(18)8-4-13;/h1-8,10-11,22H,9H2;1H |
| InChIKey | LVFHJZRUKBMTEG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |