C15H14N4O — CID 40634096
(1S)-1-phenyl-1-pyridin-4-yl-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 40634096) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is (1S)-1-phenyl-1-pyridin-4-yl-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | (1S)-1-phenyl-1-pyridin-4-yl-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 40634096 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S)-1-phenyl-1-pyridin-4-yl-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | O[C@@](Cn1cncn1)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C15H14N4O/c20-15(10-19-12-17-11-18-19,13-4-2-1-3-5-13)14-6-8-16-9-7-14/h1-9,11-12,20H,10H2/t15-/m0/s1 |
| InChIKey | SAQITQKFZDMEHL-HNNXBMFYSA-N |
| XLogP | 1.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |