C18H16N2O — CID 26793169
(1S)-1-phenyl-1,2-dipyridin-4-ylethanol (PubChem CID 26793169) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is (1S)-1-phenyl-1,2-dipyridin-4-ylethanol.
| Compound Name | (1S)-1-phenyl-1,2-dipyridin-4-ylethanol |
|---|---|
| PubChem CID | 26793169 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (1S)-1-phenyl-1,2-dipyridin-4-ylethanol |
| SMILES | O[C@@](Cc1ccncc1)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C18H16N2O/c21-18(16-4-2-1-3-5-16,17-8-12-20-13-9-17)14-15-6-10-19-11-7-15/h1-13,21H,14H2/t18-/m0/s1 |
| InChIKey | WKKZQTNBLFZMMN-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |