C19H15NO2 — CID 67444545
2-hydroxy-1,2-diphenyl-2-pyridin-4-ylethanone (PubChem CID 67444545) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenyl-2-pyridin-4-ylethanone.
| Compound Name | 2-hydroxy-1,2-diphenyl-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 67444545 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-hydroxy-1,2-diphenyl-2-pyridin-4-ylethanone |
| SMILES | O=C(c1ccccc1)C(O)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C19H15NO2/c21-18(15-7-3-1-4-8-15)19(22,16-9-5-2-6-10-16)17-11-13-20-14-12-17/h1-14,22H |
| InChIKey | OHYURDAPPWMSDW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |