About CID 161419410
CID 161419410 (PubChem CID 161419410) has the molecular formula C14H12BNaO3
and a molecular weight of 262.05 g/mol.
Molecular Properties
| Compound Name | CID 161419410 |
| PubChem CID | 161419410 |
| Molecular Formula | C14H12BNaO3 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | — |
| SMILES | O=C(O)C(O)(c1ccccc1)c1ccccc1.[B].[Na] |
| InChI | InChI=1S/C14H12O3.B.Na/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10,17H,(H,15,16);; |
| InChIKey | VWNIAVKIHXRRHC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161419410 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161419410?
The IUPAC name of CID 161419410 (CID 161419410) is not available.
What is the SMILES notation for CID 161419410?
The canonical SMILES for CID 161419410 is O=C(O)C(O)(c1ccccc1)c1ccccc1.[B].[Na].
What is the InChIKey of CID 161419410?
The InChIKey is VWNIAVKIHXRRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3.B.Na/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10,17H,(H,15,16);;.
What are the key properties of CID 161419410?
CID 161419410 has a molecular weight of 262.05 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161419410 is sourced from PubChem (CID 161419410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).