C21H25NO3 — CID 5311391
1-azabicyclo[2.2.2]octane;2-hydroxy-2,2-diphenylacetic acid (PubChem CID 5311391) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;2-hydroxy-2,2-diphenylacetic acid.
| Compound Name | 1-azabicyclo[2.2.2]octane;2-hydroxy-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 5311391 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;2-hydroxy-2,2-diphenylacetic acid |
| SMILES | C1CN2CCC1CC2.O=C(O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3.C7H13N/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-8-5-2-7(1)3-6-8/h1-10,17H,(H,15,16);7H,1-6H2 |
| InChIKey | WHBITMGYTHZKJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |