C19H25GeNO5 — CID 6328820
CID 6328820 (PubChem CID 6328820) has the molecular formula C19H25GeNO5 and a molecular weight of 420.02 g/mol.
| Compound Name | CID 6328820 |
|---|---|
| PubChem CID | 6328820 |
| Molecular Formula | C19H25GeNO5 |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | — |
| SMILES | CN(CCO)CCO.O=C(O)C(O)(c1ccccc1)c1ccccc1.[Ge] |
| InChI | InChI=1S/C14H12O3.C5H13NO2.Ge/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6(2-4-7)3-5-8;/h1-10,17H,(H,15,16);7-8H,2-5H2,1H3; |
| InChIKey | ZFVOXYNRFCMOKF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |