C16H18N2O2 — CID 12885881
2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide (PubChem CID 12885881) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide.
| Compound Name | 2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 12885881 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-hydroxy-N',N'-dimethyl-2,2-diphenylacetohydrazide |
| SMILES | CN(C)NC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c1-18(2)17-15(19)16(20,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,20H,1-2H3,(H,17,19) |
| InChIKey | GDHLVAVVXLHCRI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|