C25H26N2O3 — CID 139719107
N-tert-butyl-N'-(2-hydroxy-2,2-diphenylacetyl)benzohydrazide (PubChem CID 139719107) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-tert-butyl-N'-(2-hydroxy-2,2-diphenylacetyl)benzohydrazide.
| Compound Name | N-tert-butyl-N'-(2-hydroxy-2,2-diphenylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 139719107 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-tert-butyl-N'-(2-hydroxy-2,2-diphenylacetyl)benzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)C(O)(c1ccccc1)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3/c1-24(2,3)27(22(28)19-13-7-4-8-14-19)26-23(29)25(30,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18,30H,1-3H3,(H,26,29) |
| InChIKey | RXJZMDLIYSUZGQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|