C20H23GeN2O2 — CID 6370700
CID 6370700 (PubChem CID 6370700) has the molecular formula C20H23GeN2O2 and a molecular weight of 396.03 g/mol.
| Compound Name | CID 6370700 |
|---|---|
| PubChem CID | 6370700 |
| Molecular Formula | C20H23GeN2O2 |
| Molecular Weight | 396.03 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N(NC(=O)CC([Ge])c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23GeN2O2/c1-20(2,3)23(19(25)16-12-8-5-9-13-16)22-18(24)14-17(21)15-10-6-4-7-11-15/h4-13,17H,14H2,1-3H3,(H,22,24) |
| InChIKey | MMFPXLQXLVYWOK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.03 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|