C17H22N2O2 — CID 67921840
N-tert-butyl-3-methyl-N'-pent-3-ynoylbenzohydrazide (PubChem CID 67921840) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-tert-butyl-3-methyl-N'-pent-3-ynoylbenzohydrazide.
| Compound Name | N-tert-butyl-3-methyl-N'-pent-3-ynoylbenzohydrazide |
|---|---|
| PubChem CID | 67921840 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-tert-butyl-3-methyl-N'-pent-3-ynoylbenzohydrazide |
| SMILES | CC#CCC(=O)NN(C(=O)c1cccc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C17H22N2O2/c1-6-7-11-15(20)18-19(17(3,4)5)16(21)14-10-8-9-13(2)12-14/h8-10,12H,11H2,1-5H3,(H,18,20) |
| InChIKey | WRFRIXYBPYBWDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|