C22H26N2O3 — CID 70427476
N-tert-butyl-3-methyl-N'-(4-prop-2-enoxybenzoyl)benzohydrazide (PubChem CID 70427476) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-tert-butyl-3-methyl-N'-(4-prop-2-enoxybenzoyl)benzohydrazide.
| Compound Name | N-tert-butyl-3-methyl-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 70427476 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-tert-butyl-3-methyl-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NN(C(=O)c2cccc(C)c2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-6-14-27-19-12-10-17(11-13-19)20(25)23-24(22(3,4)5)21(26)18-9-7-8-16(2)15-18/h6-13,15H,1,14H2,2-5H3,(H,23,25) |
| InChIKey | YPJYOWPMORGLHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|