C15H19N5O2 — CID 15452007
N'-tert-butyl-N'-(3-methylbenzoyl)-2H-triazole-4-carbohydrazide (PubChem CID 15452007) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3-methylbenzoyl)-2H-triazole-4-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3-methylbenzoyl)-2H-triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 15452007 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N'-tert-butyl-N'-(3-methylbenzoyl)-2H-triazole-4-carbohydrazide |
| SMILES | Cc1cccc(C(=O)N(NC(=O)c2cn[nH]n2)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H19N5O2/c1-10-6-5-7-11(8-10)14(22)20(15(2,3)4)18-13(21)12-9-16-19-17-12/h5-9H,1-4H3,(H,18,21)(H,16,17,19) |
| InChIKey | XMMKPMQTYKFRMY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|