C20H32N2O2 — CID 67921776
N'-tert-butyl-3-methyl-N'-octanoylbenzohydrazide (PubChem CID 67921776) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N'-tert-butyl-3-methyl-N'-octanoylbenzohydrazide.
| Compound Name | N'-tert-butyl-3-methyl-N'-octanoylbenzohydrazide |
|---|---|
| PubChem CID | 67921776 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N'-tert-butyl-3-methyl-N'-octanoylbenzohydrazide |
| SMILES | CCCCCCCC(=O)N(NC(=O)c1cccc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C20H32N2O2/c1-6-7-8-9-10-14-18(23)22(20(3,4)5)21-19(24)17-13-11-12-16(2)15-17/h11-13,15H,6-10,14H2,1-5H3,(H,21,24) |
| InChIKey | SFJREPLTRPCTAG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|