C23H30N2O2 — CID 70427413
N-tert-butyl-N'-(4-tert-butylbenzoyl)-3-methylbenzohydrazide (PubChem CID 70427413) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-tert-butyl-N'-(4-tert-butylbenzoyl)-3-methylbenzohydrazide.
| Compound Name | N-tert-butyl-N'-(4-tert-butylbenzoyl)-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 70427413 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-tert-butyl-N'-(4-tert-butylbenzoyl)-3-methylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)N(NC(=O)c2ccc(C(C)(C)C)cc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-16-9-8-10-18(15-16)21(27)25(23(5,6)7)24-20(26)17-11-13-19(14-12-17)22(2,3)4/h8-15H,1-7H3,(H,24,26) |
| InChIKey | OPACRVNWABDFJP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|