C21H30N2O2 — CID 88511224
(1E)-N'-tert-butyl-N'-(3-methylbenzoyl)cyclooctene-1-carbohydrazide (PubChem CID 88511224) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (1E)-N'-tert-butyl-N'-(3-methylbenzoyl)cyclooctene-1-carbohydrazide.
| Compound Name | (1E)-N'-tert-butyl-N'-(3-methylbenzoyl)cyclooctene-1-carbohydrazide |
|---|---|
| PubChem CID | 88511224 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (1E)-N'-tert-butyl-N'-(3-methylbenzoyl)cyclooctene-1-carbohydrazide |
| SMILES | Cc1cccc(C(=O)N(NC(=O)/C2=C/CCCCCC2)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H30N2O2/c1-16-11-10-14-18(15-16)20(25)23(21(2,3)4)22-19(24)17-12-8-6-5-7-9-13-17/h10-12,14-15H,5-9,13H2,1-4H3,(H,22,24)/b17-12+ |
| InChIKey | WGTGAQUHUOWNJT-SFQUDFHCSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|