About N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide
N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide (PubChem CID 19368031) has the molecular formula C19H21ClN2O3
and a molecular weight of 360.84 g/mol. Its IUPAC name is N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide |
| PubChem CID | 19368031 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)N(NC(=O)c2ccc(Cl)cc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-19(2,3)22(18(24)14-6-5-7-16(12-14)25-4)21-17(23)13-8-10-15(20)11-9-13/h5-12H,1-4H3,(H,21,23) |
| InChIKey | CWRKVTUUMXTPBI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide?
The IUPAC name of N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide (CID 19368031) is N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide.
What is the SMILES notation for N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide?
The canonical SMILES for N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide is COc1cccc(C(=O)N(NC(=O)c2ccc(Cl)cc2)C(C)(C)C)c1.
What is the InChIKey of N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide?
The InChIKey is CWRKVTUUMXTPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O3/c1-19(2,3)22(18(24)14-6-5-7-16(12-14)25-4)21-17(23)13-8-10-15(20)11-9-13/h5-12H,1-4H3,(H,21,23).
What are the key properties of N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide?
N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide has a molecular weight of 360.84 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(4-chlorobenzoyl)-3-methoxybenzohydrazide is sourced from PubChem (CID 19368031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).