C22H20Cl2N2O3 — CID 42610446
N'-tert-butyl-N'-(3-chlorobenzoyl)-5-(4-chlorophenyl)furan-2-carbohydrazide (PubChem CID 42610446) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3-chlorobenzoyl)-5-(4-chlorophenyl)furan-2-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3-chlorobenzoyl)-5-(4-chlorophenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 42610446 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N'-tert-butyl-N'-(3-chlorobenzoyl)-5-(4-chlorophenyl)furan-2-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(-c2ccc(Cl)cc2)o1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-22(2,3)26(21(28)15-5-4-6-17(24)13-15)25-20(27)19-12-11-18(29-19)14-7-9-16(23)10-8-14/h4-13H,1-3H3,(H,25,27) |
| InChIKey | ZANQJSJJCWZRCZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|