C15H17ClN4O2S — CID 44608698
N'-tert-butyl-N'-(3-chlorobenzoyl)-4-methylthiadiazole-5-carbohydrazide (PubChem CID 44608698) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3-chlorobenzoyl)-4-methylthiadiazole-5-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3-chlorobenzoyl)-4-methylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 44608698 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N'-tert-butyl-N'-(3-chlorobenzoyl)-4-methylthiadiazole-5-carbohydrazide |
| SMILES | Cc1nnsc1C(=O)NN(C(=O)c1cccc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C15H17ClN4O2S/c1-9-12(23-19-17-9)13(21)18-20(15(2,3)4)14(22)10-6-5-7-11(16)8-10/h5-8H,1-4H3,(H,18,21) |
| InChIKey | UQKNZWXPYULZTH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|