C18H18Cl2N2O2 — CID 14626547
N-tert-butyl-2-chloro-N'-(4-chlorobenzoyl)benzohydrazide (PubChem CID 14626547) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-N'-(4-chlorobenzoyl)benzohydrazide.
| Compound Name | N-tert-butyl-2-chloro-N'-(4-chlorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 14626547 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-tert-butyl-2-chloro-N'-(4-chlorobenzoyl)benzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)cc1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-18(2,3)22(17(24)14-6-4-5-7-15(14)20)21-16(23)12-8-10-13(19)11-9-12/h4-11H,1-3H3,(H,21,23) |
| InChIKey | QEIZHWRVSXPSIZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|