C21H26Cl2N2O2Si — CID 67913113
N-tert-butyl-2,5-dichloro-N'-(4-trimethylsilylbenzoyl)benzohydrazide (PubChem CID 67913113) has the molecular formula C21H26Cl2N2O2Si and a molecular weight of 437.44 g/mol. Its IUPAC name is N-tert-butyl-2,5-dichloro-N'-(4-trimethylsilylbenzoyl)benzohydrazide.
| Compound Name | N-tert-butyl-2,5-dichloro-N'-(4-trimethylsilylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 67913113 |
| Molecular Formula | C21H26Cl2N2O2Si |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-tert-butyl-2,5-dichloro-N'-(4-trimethylsilylbenzoyl)benzohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc([Si](C)(C)C)cc1)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H26Cl2N2O2Si/c1-21(2,3)25(20(27)17-13-15(22)9-12-18(17)23)24-19(26)14-7-10-16(11-8-14)28(4,5)6/h7-13H,1-6H3,(H,24,26) |
| InChIKey | XGJADEYHVPPDHW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|