C19H18Cl2N4O5 — CID 159338091
N-[[tert-butyl-(4-nitrobenzoyl)amino]carbamoyl]-2,5-dichlorobenzamide (PubChem CID 159338091) has the molecular formula C19H18Cl2N4O5 and a molecular weight of 453.28 g/mol. Its IUPAC name is N-[[tert-butyl-(4-nitrobenzoyl)amino]carbamoyl]-2,5-dichlorobenzamide.
| Compound Name | N-[[tert-butyl-(4-nitrobenzoyl)amino]carbamoyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 159338091 |
| Molecular Formula | C19H18Cl2N4O5 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[[tert-butyl-(4-nitrobenzoyl)amino]carbamoyl]-2,5-dichlorobenzamide |
| SMILES | CC(C)(C)N(NC(=O)NC(=O)c1cc(Cl)ccc1Cl)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18Cl2N4O5/c1-19(2,3)24(17(27)11-4-7-13(8-5-11)25(29)30)23-18(28)22-16(26)14-10-12(20)6-9-15(14)21/h4-10H,1-3H3,(H2,22,23,26,28) |
| InChIKey | LFUJUDOYCHQHPG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|