C21H20ClN3O2 — CID 134106621
N-tert-butyl-N'-(4-chlorobenzoyl)quinoline-8-carbohydrazide (PubChem CID 134106621) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is N-tert-butyl-N'-(4-chlorobenzoyl)quinoline-8-carbohydrazide.
| Compound Name | N-tert-butyl-N'-(4-chlorobenzoyl)quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 134106621 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-tert-butyl-N'-(4-chlorobenzoyl)quinoline-8-carbohydrazide |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)cc1)C(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C21H20ClN3O2/c1-21(2,3)25(24-19(26)15-9-11-16(22)12-10-15)20(27)17-8-4-6-14-7-5-13-23-18(14)17/h4-13H,1-3H3,(H,24,26) |
| InChIKey | FDQAAJHOMVFWPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|