C18H22ClN5O4 — CID 140969445
1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(4,6-dimethoxypyrimidin-2-yl)urea (PubChem CID 140969445) has the molecular formula C18H22ClN5O4 and a molecular weight of 407.86 g/mol. Its IUPAC name is 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(4,6-dimethoxypyrimidin-2-yl)urea.
| Compound Name | 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(4,6-dimethoxypyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 140969445 |
| Molecular Formula | C18H22ClN5O4 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(4,6-dimethoxypyrimidin-2-yl)urea |
| SMILES | COc1cc(OC)nc(NC(=O)N(NC(=O)c2ccc(Cl)cc2)C(C)(C)C)n1 |
| InChI | InChI=1S/C18H22ClN5O4/c1-18(2,3)24(23-15(25)11-6-8-12(19)9-7-11)17(26)22-16-20-13(27-4)10-14(21-16)28-5/h6-10H,1-5H3,(H,23,25)(H,20,21,22,26) |
| InChIKey | YXQIWAFMTCOQRO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|