C13H11ClN2O3 — CID 708347
(4-chlorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanone (PubChem CID 708347) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.70 g/mol. Its IUPAC name is (4-chlorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 708347 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (4-chlorophenyl)-(4,6-dimethoxypyrimidin-2-yl)methanone |
| SMILES | COc1cc(OC)nc(C(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H11ClN2O3/c1-18-10-7-11(19-2)16-13(15-10)12(17)8-3-5-9(14)6-4-8/h3-7H,1-2H3 |
| InChIKey | LPYUBFXOYRJZCD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |