About N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide
N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide (PubChem CID 67133377) has the molecular formula C15H14ClN3O4
and a molecular weight of 335.75 g/mol. Its IUPAC name is N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide |
| PubChem CID | 67133377 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide |
| SMILES | COc1cc(OC)nc(C(=O)c2cccc(Cl)c2NC(C)=O)n1 |
| InChI | InChI=1S/C15H14ClN3O4/c1-8(20)17-13-9(5-4-6-10(13)16)14(21)15-18-11(22-2)7-12(19-15)23-3/h4-7H,1-3H3,(H,17,20) |
| InChIKey | MKRZZYZZILMZEL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide?
The IUPAC name of N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide (CID 67133377) is N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide.
What is the SMILES notation for N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide?
The canonical SMILES for N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide is COc1cc(OC)nc(C(=O)c2cccc(Cl)c2NC(C)=O)n1.
What is the InChIKey of N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide?
The InChIKey is MKRZZYZZILMZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O4/c1-8(20)17-13-9(5-4-6-10(13)16)14(21)15-18-11(22-2)7-12(19-15)23-3/h4-7H,1-3H3,(H,17,20).
What are the key properties of N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide?
N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide has a molecular weight of 335.75 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-6-(4,6-dimethoxypyrimidine-2-carbonyl)phenyl]acetamide is sourced from PubChem (CID 67133377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).