C15H15N3O5 — CID 18417992
(4,6-dimethoxypyrimidin-2-yl)-(3-ethyl-2-nitrophenyl)methanone (PubChem CID 18417992) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is (4,6-dimethoxypyrimidin-2-yl)-(3-ethyl-2-nitrophenyl)methanone.
| Compound Name | (4,6-dimethoxypyrimidin-2-yl)-(3-ethyl-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 18417992 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (4,6-dimethoxypyrimidin-2-yl)-(3-ethyl-2-nitrophenyl)methanone |
| SMILES | CCc1cccc(C(=O)c2nc(OC)cc(OC)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O5/c1-4-9-6-5-7-10(13(9)18(20)21)14(19)15-16-11(22-2)8-12(17-15)23-3/h5-8H,4H2,1-3H3 |
| InChIKey | QGXKWHAUJAYDAL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|