C15H14FN3O6 — CID 141342160
(4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-(methoxymethyl)-2-nitrophenyl]methanone (PubChem CID 141342160) has the molecular formula C15H14FN3O6 and a molecular weight of 351.29 g/mol. Its IUPAC name is (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-(methoxymethyl)-2-nitrophenyl]methanone.
| Compound Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-(methoxymethyl)-2-nitrophenyl]methanone |
|---|---|
| PubChem CID | 141342160 |
| Molecular Formula | C15H14FN3O6 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-(methoxymethyl)-2-nitrophenyl]methanone |
| SMILES | COCc1cc(F)cc(C(=O)c2nc(OC)cc(OC)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14FN3O6/c1-23-7-8-4-9(16)5-10(13(8)19(21)22)14(20)15-17-11(24-2)6-12(18-15)25-3/h4-6H,7H2,1-3H3 |
| InChIKey | CIMPMXVJPHTRKH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|