C17H20FN3O6 — CID 141342125
(4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-2-nitro-3-(propoxymethyl)phenyl]methanol (PubChem CID 141342125) has the molecular formula C17H20FN3O6 and a molecular weight of 381.36 g/mol. Its IUPAC name is (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-2-nitro-3-(propoxymethyl)phenyl]methanol.
| Compound Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-2-nitro-3-(propoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 141342125 |
| Molecular Formula | C17H20FN3O6 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-2-nitro-3-(propoxymethyl)phenyl]methanol |
| SMILES | CCCOCc1cc(F)cc(C(O)c2nc(OC)cc(OC)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20FN3O6/c1-4-5-27-9-10-6-11(18)7-12(15(10)21(23)24)16(22)17-19-13(25-2)8-14(20-17)26-3/h6-8,16,22H,4-5,9H2,1-3H3 |
| InChIKey | UTVMUHMQDZMWHI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|