C18H22FN3O6 — CID 141342130
(4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]-2-nitrophenyl]methanol (PubChem CID 141342130) has the molecular formula C18H22FN3O6 and a molecular weight of 395.39 g/mol. Its IUPAC name is (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]-2-nitrophenyl]methanol.
| Compound Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]-2-nitrophenyl]methanol |
|---|---|
| PubChem CID | 141342130 |
| Molecular Formula | C18H22FN3O6 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (4,6-dimethoxypyrimidin-2-yl)-[5-fluoro-3-[(2-methylpropan-2-yl)oxymethyl]-2-nitrophenyl]methanol |
| SMILES | COc1cc(OC)nc(C(O)c2cc(F)cc(COC(C)(C)C)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H22FN3O6/c1-18(2,3)28-9-10-6-11(19)7-12(15(10)22(24)25)16(23)17-20-13(26-4)8-14(21-17)27-5/h6-8,16,23H,9H2,1-5H3 |
| InChIKey | MTEAQRCPAWVOPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|