C17H18BrN3O6 — CID 141342114
[5-bromo-2-nitro-3-(propan-2-yloxymethyl)phenyl]-(4,6-dimethoxypyrimidin-2-yl)methanone (PubChem CID 141342114) has the molecular formula C17H18BrN3O6 and a molecular weight of 440.25 g/mol. Its IUPAC name is [5-bromo-2-nitro-3-(propan-2-yloxymethyl)phenyl]-(4,6-dimethoxypyrimidin-2-yl)methanone.
| Compound Name | [5-bromo-2-nitro-3-(propan-2-yloxymethyl)phenyl]-(4,6-dimethoxypyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 141342114 |
| Molecular Formula | C17H18BrN3O6 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | [5-bromo-2-nitro-3-(propan-2-yloxymethyl)phenyl]-(4,6-dimethoxypyrimidin-2-yl)methanone |
| SMILES | COc1cc(OC)nc(C(=O)c2cc(Br)cc(COC(C)C)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H18BrN3O6/c1-9(2)27-8-10-5-11(18)6-12(15(10)21(23)24)16(22)17-19-13(25-3)7-14(20-17)26-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | QSYPDQPIDATQOP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|