About N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide
N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide (PubChem CID 67133435) has the molecular formula C17H21N3O5
and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide |
| PubChem CID | 67133435 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide |
| SMILES | COCc1cccc(C(O)c2nc(OC)cc(OC)n2)c1NC(C)=O |
| InChI | InChI=1S/C17H21N3O5/c1-10(21)18-15-11(9-23-2)6-5-7-12(15)16(22)17-19-13(24-3)8-14(20-17)25-4/h5-8,16,22H,9H2,1-4H3,(H,18,21) |
| InChIKey | UITALRLUUIMHNR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide?
The IUPAC name of N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide (CID 67133435) is N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide.
What is the SMILES notation for N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide?
The canonical SMILES for N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide is COCc1cccc(C(O)c2nc(OC)cc(OC)n2)c1NC(C)=O.
What is the InChIKey of N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide?
The InChIKey is UITALRLUUIMHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5/c1-10(21)18-15-11(9-23-2)6-5-7-12(15)16(22)17-19-13(24-3)8-14(20-17)25-4/h5-8,16,22H,9H2,1-4H3,(H,18,21).
What are the key properties of N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide?
N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide has a molecular weight of 347.37 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]acetamide is sourced from PubChem (CID 67133435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).