C10H16N4O4 — CID 107625774
2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methoxypropanamide (PubChem CID 107625774) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 107625774 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C10H16N4O4/c1-16-5-6(11)9(15)14-10-12-7(17-2)4-8(13-10)18-3/h4,6H,5,11H2,1-3H3,(H,12,13,14,15) |
| InChIKey | VSJACXUFYPOCHQ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |