C12H20N4O3 — CID 107625737
(2S)-2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methylpentanamide (PubChem CID 107625737) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is (2S)-2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 107625737 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (2S)-2-amino-N-(4,6-dimethoxypyrimidin-2-yl)-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-5-7(2)10(13)11(17)16-12-14-8(18-3)6-9(15-12)19-4/h6-7,10H,5,13H2,1-4H3,(H,14,15,16,17)/t7?,10-/m0/s1 |
| InChIKey | NWGHCONWWAULBB-MHPPCMCBSA-N |
| XLogP | 0.81 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |