C12H21Cl2N3O — CID 119832869
2-amino-3-methyl-N-(2-methyl-4-pyridinyl)pentanamide;dihydrochloride (PubChem CID 119832869) has the molecular formula C12H21Cl2N3O and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(2-methyl-4-pyridinyl)pentanamide;dihydrochloride.
| Compound Name | 2-amino-3-methyl-N-(2-methyl-4-pyridinyl)pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119832869 |
| Molecular Formula | C12H21Cl2N3O |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-amino-3-methyl-N-(2-methyl-4-pyridinyl)pentanamide;dihydrochloride |
| SMILES | CCC(C)C(N)C(=O)Nc1ccnc(C)c1.Cl.Cl |
| InChI | InChI=1S/C12H19N3O.2ClH/c1-4-8(2)11(13)12(16)15-10-5-6-14-9(3)7-10;;/h5-8,11H,4,13H2,1-3H3,(H,14,15,16);2*1H |
| InChIKey | ZFWBYBWUYIJVCO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |